C22H25NO5S — CID 7901030
(4-methylphenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate (PubChem CID 7901030) has the molecular formula C22H25NO5S and a molecular weight of 415.51 g/mol. Its IUPAC name is (4-methylphenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | (4-methylphenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7901030 |
| Molecular Formula | C22H25NO5S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (4-methylphenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(C)cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H25NO5S/c1-17-6-10-19(11-7-17)28-22(24)13-9-18-8-12-20(27-2)21(16-18)29(25,26)23-14-4-3-5-15-23/h6-13,16H,3-5,14-15H2,1-2H3/b13-9+ |
| InChIKey | JDLJJMLXCKPWRS-UKTHLTGXSA-N |
| XLogP | 3.80 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|