C27H25NO6S — CID 3363765
dibenzofuran-2-yl 3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate (PubChem CID 3363765) has the molecular formula C27H25NO6S and a molecular weight of 491.57 g/mol. Its IUPAC name is dibenzofuran-2-yl 3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | dibenzofuran-2-yl 3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3363765 |
| Molecular Formula | C27H25NO6S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | dibenzofuran-2-yl 3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2ccc3oc4ccccc4c3c2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C27H25NO6S/c1-32-25-12-9-19(17-26(25)35(30,31)28-15-5-2-6-16-28)10-14-27(29)33-20-11-13-24-22(18-20)21-7-3-4-8-23(21)34-24/h3-4,7-14,17-18H,2,5-6,15-16H2,1H3 |
| InChIKey | FCXZWIWTWOTNEH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|