C21H22BrNO5S — CID 2667054
(4-bromophenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate (PubChem CID 2667054) has the molecular formula C21H22BrNO5S and a molecular weight of 480.38 g/mol. Its IUPAC name is (4-bromophenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | (4-bromophenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2667054 |
| Molecular Formula | C21H22BrNO5S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | (4-bromophenyl) (E)-3-(4-methoxy-3-piperidin-1-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2ccc(Br)cc2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H22BrNO5S/c1-27-19-11-5-16(6-12-21(24)28-18-9-7-17(22)8-10-18)15-20(19)29(25,26)23-13-3-2-4-14-23/h5-12,15H,2-4,13-14H2,1H3/b12-6+ |
| InChIKey | QHCGVYNJAFBYJD-WUXMJOGZSA-N |
| XLogP | 4.25 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|