C16H21NO6S — CID 47081365
methyl (E)-3-(3,4-dimethoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoate (PubChem CID 47081365) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is methyl (E)-3-(3,4-dimethoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoate.
| Compound Name | methyl (E)-3-(3,4-dimethoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 47081365 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl (E)-3-(3,4-dimethoxy-5-pyrrolidin-1-ylsulfonylphenyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(OC)c(OC)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H21NO6S/c1-21-13-10-12(6-7-15(18)22-2)11-14(16(13)23-3)24(19,20)17-8-4-5-9-17/h6-7,10-11H,4-5,8-9H2,1-3H3/b7-6+ |
| InChIKey | OVKVKIFZQZGDFW-VOTSOKGWSA-N |
| XLogP | 1.67 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|