C19H24N4O6S — CID 100840108
methyl (Z)-3-[3,4-dimethoxy-5-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]sulfonylphenyl]prop-2-enoate (PubChem CID 100840108) has the molecular formula C19H24N4O6S and a molecular weight of 436.49 g/mol. Its IUPAC name is methyl (Z)-3-[3,4-dimethoxy-5-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]sulfonylphenyl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[3,4-dimethoxy-5-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]sulfonylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 100840108 |
| Molecular Formula | C19H24N4O6S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | methyl (Z)-3-[3,4-dimethoxy-5-[(3R)-3-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]sulfonylphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C\c1cc(OC)c(OC)c(S(=O)(=O)N2CCC[C@@H](c3ncn[nH]3)C2)c1 |
| InChI | InChI=1S/C19H24N4O6S/c1-27-15-9-13(6-7-17(24)28-2)10-16(18(15)29-3)30(25,26)23-8-4-5-14(11-23)19-20-12-21-22-19/h6-7,9-10,12,14H,4-5,8,11H2,1-3H3,(H,20,21,22)/b7-6-/t14-/m1/s1 |
| InChIKey | SNJJIYTYSORPEH-LMVHVUTASA-N |
| XLogP | 1.58 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|