C22H23NO6S — CID 2445224
(E)-3-[3,4-dimethoxy-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]prop-2-enoic acid (PubChem CID 2445224) has the molecular formula C22H23NO6S and a molecular weight of 429.49 g/mol. Its IUPAC name is (E)-3-[3,4-dimethoxy-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,4-dimethoxy-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2445224 |
| Molecular Formula | C22H23NO6S |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | (E)-3-[3,4-dimethoxy-5-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(S(=O)(=O)N2CC=C(c3ccccc3)CC2)c1OC |
| InChI | InChI=1S/C22H23NO6S/c1-28-19-14-16(8-9-21(24)25)15-20(22(19)29-2)30(26,27)23-12-10-18(11-13-23)17-6-4-3-5-7-17/h3-10,14-15H,11-13H2,1-2H3,(H,24,25)/b9-8+ |
| InChIKey | LTEIMUAKOMMYRS-CMDGGOBGSA-N |
| XLogP | 3.28 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|