C17H21NO8S — CID 1336428
1-[5-[(E)-2-carboxyethenyl]-2,3-dimethoxyphenyl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 1336428) has the molecular formula C17H21NO8S and a molecular weight of 399.42 g/mol. Its IUPAC name is 1-[5-[(E)-2-carboxyethenyl]-2,3-dimethoxyphenyl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-[5-[(E)-2-carboxyethenyl]-2,3-dimethoxyphenyl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 1336428 |
| Molecular Formula | C17H21NO8S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 1-[5-[(E)-2-carboxyethenyl]-2,3-dimethoxyphenyl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(S(=O)(=O)N2CCC(C(=O)O)CC2)c1OC |
| InChI | InChI=1S/C17H21NO8S/c1-25-13-9-11(3-4-15(19)20)10-14(16(13)26-2)27(23,24)18-7-5-12(6-8-18)17(21)22/h3-4,9-10,12H,5-8H2,1-2H3,(H,19,20)(H,21,22)/b4-3+ |
| InChIKey | GQIBQQLWRFNJJK-ONEGZZNKSA-N |
| XLogP | 1.29 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|