C18H24N2O7S — CID 2473312
(E)-3-[3,4-dimethoxy-5-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 2473312) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is (E)-3-[3,4-dimethoxy-5-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,4-dimethoxy-5-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2473312 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (E)-3-[3,4-dimethoxy-5-[3-(2-oxopyrrolidin-1-yl)propylsulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(S(=O)(=O)NCCCN2CCCC2=O)c1OC |
| InChI | InChI=1S/C18H24N2O7S/c1-26-14-11-13(6-7-17(22)23)12-15(18(14)27-2)28(24,25)19-8-4-10-20-9-3-5-16(20)21/h6-7,11-12,19H,3-5,8-10H2,1-2H3,(H,22,23)/b7-6+ |
| InChIKey | CDCHSXGCERZKSQ-VOTSOKGWSA-N |
| XLogP | 1.09 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|