C16H23NO6S — CID 47081369
methyl (E)-3-[3-(tert-butylsulfamoyl)-4,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 47081369) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is methyl (E)-3-[3-(tert-butylsulfamoyl)-4,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-(tert-butylsulfamoyl)-4,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 47081369 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | methyl (E)-3-[3-(tert-butylsulfamoyl)-4,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(OC)c(OC)c(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C16H23NO6S/c1-16(2,3)17-24(19,20)13-10-11(7-8-14(18)22-5)9-12(21-4)15(13)23-6/h7-10,17H,1-6H3/b8-7+ |
| InChIKey | CTSRBAALESJGMH-BQYQJAHWSA-N |
| XLogP | 1.97 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|