C17H17ClN2O6S — CID 56532190
methyl (E)-3-[3-[(6-chloro-3-pyridinyl)sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 56532190) has the molecular formula C17H17ClN2O6S and a molecular weight of 412.85 g/mol. Its IUPAC name is methyl (E)-3-[3-[(6-chloro-3-pyridinyl)sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[(6-chloro-3-pyridinyl)sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 56532190 |
| Molecular Formula | C17H17ClN2O6S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | methyl (E)-3-[3-[(6-chloro-3-pyridinyl)sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(OC)c(OC)c(S(=O)(=O)Nc2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C17H17ClN2O6S/c1-24-13-8-11(4-7-16(21)25-2)9-14(17(13)26-3)27(22,23)20-12-5-6-15(18)19-10-12/h4-10,20H,1-3H3/b7-4+ |
| InChIKey | BIWGEMIPJBHISB-QPJJXVBHSA-N |
| XLogP | 2.74 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|