C18H15NO8S-2 — CID 4750831
4-[[5-(2-carboxylatoethenyl)-2,3-dimethoxyphenyl]sulfonylamino]benzoate (PubChem CID 4750831) has the molecular formula C18H15NO8S-2 and a molecular weight of 405.38 g/mol. Its IUPAC name is 4-[[5-(2-carboxylatoethenyl)-2,3-dimethoxyphenyl]sulfonylamino]benzoate.
| Compound Name | 4-[[5-(2-carboxylatoethenyl)-2,3-dimethoxyphenyl]sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4750831 |
| Molecular Formula | C18H15NO8S-2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | 4-[[5-(2-carboxylatoethenyl)-2,3-dimethoxyphenyl]sulfonylamino]benzoate |
| SMILES | COc1cc(C=CC(=O)[O-])cc(S(=O)(=O)Nc2ccc(C(=O)[O-])cc2)c1OC |
| InChI | InChI=1S/C18H17NO8S/c1-26-14-9-11(3-8-16(20)21)10-15(17(14)27-2)28(24,25)19-13-6-4-12(5-7-13)18(22)23/h3-10,19H,1-2H3,(H,20,21)(H,22,23)/p-2 |
| InChIKey | WIFPZDZJNRLTLB-UHFFFAOYSA-L |
| XLogP | -0.37 |
| TPSA | 144.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|