C27H28ClN3O9S2 — CID 6218117
(E)-3-[3-[[3-[(4-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 6218117) has the molecular formula C27H28ClN3O9S2 and a molecular weight of 638.12 g/mol. Its IUPAC name is (E)-3-[3-[[3-[(4-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[3-[(4-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6218117 |
| Molecular Formula | C27H28ClN3O9S2 |
| Molecular Weight | 638.12 g/mol |
| Exact Mass | 637.10 |
| IUPAC Name | (E)-3-[3-[[3-[(4-chlorophenyl)sulfamoyl]-4-morpholin-4-ylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(S(=O)(=O)Nc2ccc(N3CCOCC3)c(S(=O)(=O)Nc3ccc(Cl)cc3)c2)c1OC |
| InChI | InChI=1S/C27H28ClN3O9S2/c1-38-23-15-18(3-10-26(32)33)16-25(27(23)39-2)42(36,37)30-21-8-9-22(31-11-13-40-14-12-31)24(17-21)41(34,35)29-20-6-4-19(28)5-7-20/h3-10,15-17,29-30H,11-14H2,1-2H3,(H,32,33)/b10-3+ |
| InChIKey | OPPNSTVAVAZRAV-XCVCLJGOSA-N |
| XLogP | 3.89 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.12 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|