C18H17N3O7S — CID 4830724
3-[3,4-dimethoxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 4830724) has the molecular formula C18H17N3O7S and a molecular weight of 419.42 g/mol. Its IUPAC name is 3-[3,4-dimethoxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3,4-dimethoxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 4830724 |
| Molecular Formula | C18H17N3O7S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 3-[3,4-dimethoxy-5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)cc(S(=O)(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1OC |
| InChI | InChI=1S/C18H17N3O7S/c1-27-14-7-10(3-6-16(22)23)8-15(17(14)28-2)29(25,26)21-11-4-5-12-13(9-11)20-18(24)19-12/h3-9,21H,1-2H3,(H,22,23)(H2,19,20,24) |
| InChIKey | RAEXPPRJEAWATF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|