C22H28N2O8S2 — CID 6216488
(E)-3-[3-[[5-(diethylsulfamoyl)-2-methylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid (PubChem CID 6216488) has the molecular formula C22H28N2O8S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is (E)-3-[3-[[5-(diethylsulfamoyl)-2-methylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[5-(diethylsulfamoyl)-2-methylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6216488 |
| Molecular Formula | C22H28N2O8S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | (E)-3-[3-[[5-(diethylsulfamoyl)-2-methylphenyl]sulfamoyl]-4,5-dimethoxyphenyl]prop-2-enoic acid |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NS(=O)(=O)c2cc(/C=C/C(=O)O)cc(OC)c2OC)c1 |
| InChI | InChI=1S/C22H28N2O8S2/c1-6-24(7-2)34(29,30)17-10-8-15(3)18(14-17)23-33(27,28)20-13-16(9-11-21(25)26)12-19(31-4)22(20)32-5/h8-14,23H,6-7H2,1-5H3,(H,25,26)/b11-9+ |
| InChIKey | JRZBNJXTGNHTDM-PKNBQFBNSA-N |
| XLogP | 2.94 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|