C23H21NO6S2 — CID 2086855
(E)-3-[3,4-dimethoxy-5-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 2086855) has the molecular formula C23H21NO6S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is (E)-3-[3,4-dimethoxy-5-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,4-dimethoxy-5-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2086855 |
| Molecular Formula | C23H21NO6S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | (E)-3-[3,4-dimethoxy-5-[(2-phenylsulfanylphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(S(=O)(=O)Nc2ccccc2Sc2ccccc2)c1OC |
| InChI | InChI=1S/C23H21NO6S2/c1-29-19-14-16(12-13-22(25)26)15-21(23(19)30-2)32(27,28)24-18-10-6-7-11-20(18)31-17-8-4-3-5-9-17/h3-15,24H,1-2H3,(H,25,26)/b13-12+ |
| InChIKey | UUCMWFPKLLHRBF-OUKQBFOZSA-N |
| XLogP | 4.75 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|