C17H25NO6S — CID 52510179
methyl (E)-3-[3,4-dimethoxy-5-[[(2S)-3-methylbutan-2-yl]sulfamoyl]phenyl]prop-2-enoate (PubChem CID 52510179) has the molecular formula C17H25NO6S and a molecular weight of 371.46 g/mol. Its IUPAC name is methyl (E)-3-[3,4-dimethoxy-5-[[(2S)-3-methylbutan-2-yl]sulfamoyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3,4-dimethoxy-5-[[(2S)-3-methylbutan-2-yl]sulfamoyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 52510179 |
| Molecular Formula | C17H25NO6S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | methyl (E)-3-[3,4-dimethoxy-5-[[(2S)-3-methylbutan-2-yl]sulfamoyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(OC)c(OC)c(S(=O)(=O)N[C@@H](C)C(C)C)c1 |
| InChI | InChI=1S/C17H25NO6S/c1-11(2)12(3)18-25(20,21)15-10-13(7-8-16(19)23-5)9-14(22-4)17(15)24-6/h7-12,18H,1-6H3/b8-7+/t12-/m0/s1 |
| InChIKey | PRLAEJQQHJGAAY-GUOLPTJISA-N |
| XLogP | 2.21 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|