C22H21N3O6S — CID 39000645
(E)-3-[3,4-dimethoxy-5-[[3-(2-methylpyrimidin-4-yl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 39000645) has the molecular formula C22H21N3O6S and a molecular weight of 455.49 g/mol. Its IUPAC name is (E)-3-[3,4-dimethoxy-5-[[3-(2-methylpyrimidin-4-yl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,4-dimethoxy-5-[[3-(2-methylpyrimidin-4-yl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39000645 |
| Molecular Formula | C22H21N3O6S |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (E)-3-[3,4-dimethoxy-5-[[3-(2-methylpyrimidin-4-yl)phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)cc(S(=O)(=O)Nc2cccc(-c3ccnc(C)n3)c2)c1OC |
| InChI | InChI=1S/C22H21N3O6S/c1-14-23-10-9-18(24-14)16-5-4-6-17(13-16)25-32(28,29)20-12-15(7-8-21(26)27)11-19(30-2)22(20)31-3/h4-13,25H,1-3H3,(H,26,27)/b8-7+ |
| InChIKey | MYRDMTPCZUUTBQ-BQYQJAHWSA-N |
| XLogP | 3.37 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|