C18H20N2O6S — CID 2089032
(Z)-3-[3,4-dimethoxy-5-(2-pyridin-2-ylethylsulfamoyl)phenyl]prop-2-enoic acid (PubChem CID 2089032) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (Z)-3-[3,4-dimethoxy-5-(2-pyridin-2-ylethylsulfamoyl)phenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[3,4-dimethoxy-5-(2-pyridin-2-ylethylsulfamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 2089032 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (Z)-3-[3,4-dimethoxy-5-(2-pyridin-2-ylethylsulfamoyl)phenyl]prop-2-enoic acid |
| SMILES | COc1cc(/C=C\C(=O)O)cc(S(=O)(=O)NCCc2ccccn2)c1OC |
| InChI | InChI=1S/C18H20N2O6S/c1-25-15-11-13(6-7-17(21)22)12-16(18(15)26-2)27(23,24)20-10-8-14-5-3-4-9-19-14/h3-7,9,11-12,20H,8,10H2,1-2H3,(H,21,22)/b7-6- |
| InChIKey | VJGDEFZKRQJWER-SREVYHEPSA-N |
| XLogP | 1.72 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|