C14H17NO7S — CID 2769939
4-[[5-(2-carboxyethenyl)-2-methoxyphenyl]sulfonylamino]butanoic acid (PubChem CID 2769939) has the molecular formula C14H17NO7S and a molecular weight of 343.36 g/mol. Its IUPAC name is 4-[[5-(2-carboxyethenyl)-2-methoxyphenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-[[5-(2-carboxyethenyl)-2-methoxyphenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 2769939 |
| Molecular Formula | C14H17NO7S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 4-[[5-(2-carboxyethenyl)-2-methoxyphenyl]sulfonylamino]butanoic acid |
| SMILES | COc1ccc(C=CC(=O)O)cc1S(=O)(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H17NO7S/c1-22-11-6-4-10(5-7-14(18)19)9-12(11)23(20,21)15-8-2-3-13(16)17/h4-7,9,15H,2-3,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | GVBFBJIIKMWHRK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|