C15H20NO6S- — CID 9160581
(E)-3-[3-(3-ethoxypropylsulfamoyl)-4-methoxyphenyl]prop-2-enoate (PubChem CID 9160581) has the molecular formula C15H20NO6S- and a molecular weight of 342.39 g/mol. Its IUPAC name is (E)-3-[3-(3-ethoxypropylsulfamoyl)-4-methoxyphenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-(3-ethoxypropylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 9160581 |
| Molecular Formula | C15H20NO6S- |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | (E)-3-[3-(3-ethoxypropylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
| SMILES | CCOCCCNS(=O)(=O)c1cc(/C=C/C(=O)[O-])ccc1OC |
| InChI | InChI=1S/C15H21NO6S/c1-3-22-10-4-9-16-23(19,20)14-11-12(6-8-15(17)18)5-7-13(14)21-2/h5-8,11,16H,3-4,9-10H2,1-2H3,(H,17,18)/p-1/b8-6+ |
| InChIKey | LGVZVTPGYBFETC-SOFGYWHQSA-M |
| XLogP | 0.16 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|