C14H24N2O4S — CID 106019817
N-(2-ethoxyethyl)-5-(ethylaminomethyl)-2-methoxybenzenesulfonamide (PubChem CID 106019817) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-5-(ethylaminomethyl)-2-methoxybenzenesulfonamide.
| Compound Name | N-(2-ethoxyethyl)-5-(ethylaminomethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106019817 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | N-(2-ethoxyethyl)-5-(ethylaminomethyl)-2-methoxybenzenesulfonamide |
| SMILES | CCNCc1ccc(OC)c(S(=O)(=O)NCCOCC)c1 |
| InChI | InChI=1S/C14H24N2O4S/c1-4-15-11-12-6-7-13(19-3)14(10-12)21(17,18)16-8-9-20-5-2/h6-7,10,15-16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | RHQSGTQYNUFZPN-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|