C12H19BrN2O3S — CID 106019809
2-bromo-N-(2-ethoxyethyl)-5-(methylaminomethyl)benzenesulfonamide (PubChem CID 106019809) has the molecular formula C12H19BrN2O3S and a molecular weight of 351.27 g/mol. Its IUPAC name is 2-bromo-N-(2-ethoxyethyl)-5-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-(2-ethoxyethyl)-5-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106019809 |
| Molecular Formula | C12H19BrN2O3S |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-bromo-N-(2-ethoxyethyl)-5-(methylaminomethyl)benzenesulfonamide |
| SMILES | CCOCCNS(=O)(=O)c1cc(CNC)ccc1Br |
| InChI | InChI=1S/C12H19BrN2O3S/c1-3-18-7-6-15-19(16,17)12-8-10(9-14-2)4-5-11(12)13/h4-5,8,14-15H,3,6-7,9H2,1-2H3 |
| InChIKey | VDVFEPBVCRZDDQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|