C14H21BrN2O3S — CID 106090990
2-bromo-N-[(1-methoxycyclobutyl)methyl]-5-(methylaminomethyl)benzenesulfonamide (PubChem CID 106090990) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is 2-bromo-N-[(1-methoxycyclobutyl)methyl]-5-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 2-bromo-N-[(1-methoxycyclobutyl)methyl]-5-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106090990 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-bromo-N-[(1-methoxycyclobutyl)methyl]-5-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1ccc(Br)c(S(=O)(=O)NCC2(OC)CCC2)c1 |
| InChI | InChI=1S/C14H21BrN2O3S/c1-16-9-11-4-5-12(15)13(8-11)21(18,19)17-10-14(20-2)6-3-7-14/h4-5,8,16-17H,3,6-7,9-10H2,1-2H3 |
| InChIKey | AGSZFAUNZIHNRY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |