C13H22N2O3S — CID 106020217
N-(2-ethoxyethyl)-1-[4-(methylaminomethyl)phenyl]methanesulfonamide (PubChem CID 106020217) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-1-[4-(methylaminomethyl)phenyl]methanesulfonamide.
| Compound Name | N-(2-ethoxyethyl)-1-[4-(methylaminomethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 106020217 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(2-ethoxyethyl)-1-[4-(methylaminomethyl)phenyl]methanesulfonamide |
| SMILES | CCOCCNS(=O)(=O)Cc1ccc(CNC)cc1 |
| InChI | InChI=1S/C13H22N2O3S/c1-3-18-9-8-15-19(16,17)11-13-6-4-12(5-7-13)10-14-2/h4-7,14-15H,3,8-11H2,1-2H3 |
| InChIKey | CUAMQZQQMABBRT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|