C17H15ClNO5S- — CID 9160607
(E)-3-[3-[(2-chlorophenyl)methylsulfamoyl]-4-methoxyphenyl]prop-2-enoate (PubChem CID 9160607) has the molecular formula C17H15ClNO5S- and a molecular weight of 380.83 g/mol. Its IUPAC name is (E)-3-[3-[(2-chlorophenyl)methylsulfamoyl]-4-methoxyphenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-[(2-chlorophenyl)methylsulfamoyl]-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 9160607 |
| Molecular Formula | C17H15ClNO5S- |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (E)-3-[3-[(2-chlorophenyl)methylsulfamoyl]-4-methoxyphenyl]prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)[O-])cc1S(=O)(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C17H16ClNO5S/c1-24-15-8-6-12(7-9-17(20)21)10-16(15)25(22,23)19-11-13-4-2-3-5-14(13)18/h2-10,19H,11H2,1H3,(H,20,21)/p-1/b9-7+ |
| InChIKey | JAKLMFPLICIHEE-VQHVLOKHSA-M |
| XLogP | 1.59 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|