C18H27NO5S — CID 165475919
tert-butyl (E)-3-[3-(tert-butylsulfamoyl)-4-methoxyphenyl]prop-2-enoate (PubChem CID 165475919) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is tert-butyl (E)-3-[3-(tert-butylsulfamoyl)-4-methoxyphenyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[3-(tert-butylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 165475919 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | tert-butyl (E)-3-[3-(tert-butylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OC(C)(C)C)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C18H27NO5S/c1-17(2,3)19-25(21,22)15-12-13(8-10-14(15)23-7)9-11-16(20)24-18(4,5)6/h8-12,19H,1-7H3/b11-9+ |
| InChIKey | SMBIILJETXDGGV-PKNBQFBNSA-N |
| XLogP | 3.13 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|