C23H28N2O6S — CID 32502775
[2-(4-tert-butylanilino)-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 32502775) has the molecular formula C23H28N2O6S and a molecular weight of 460.55 g/mol. Its IUPAC name is [2-(4-tert-butylanilino)-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-(4-tert-butylanilino)-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 32502775 |
| Molecular Formula | C23H28N2O6S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [2-(4-tert-butylanilino)-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)OCC(=O)Nc2ccc(C(C)(C)C)cc2)ccc1OC |
| InChI | InChI=1S/C23H28N2O6S/c1-23(2,3)17-8-10-18(11-9-17)25-21(26)15-31-22(27)13-7-16-6-12-19(30-5)20(14-16)32(28,29)24-4/h6-14,24H,15H2,1-5H3,(H,25,26)/b13-7+ |
| InChIKey | UUPFFWOVNVBRTQ-NTUHNPAUSA-N |
| XLogP | 3.10 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|