C20H21BrN2O6S — CID 55322551
[1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 55322551) has the molecular formula C20H21BrN2O6S and a molecular weight of 497.37 g/mol. Its IUPAC name is [1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 55322551 |
| Molecular Formula | C20H21BrN2O6S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | [1-(4-bromoanilino)-1-oxopropan-2-yl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)OC(C)C(=O)Nc2ccc(Br)cc2)ccc1OC |
| InChI | InChI=1S/C20H21BrN2O6S/c1-13(20(25)23-16-8-6-15(21)7-9-16)29-19(24)11-5-14-4-10-17(28-3)18(12-14)30(26,27)22-2/h4-13,22H,1-3H3,(H,23,25)/b11-5+ |
| InChIKey | KFRBTNGVPKEDTA-VZUCSPMQSA-N |
| XLogP | 2.95 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|