C20H20F2N2O7S — CID 31977934
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate (PubChem CID 31977934) has the molecular formula C20H20F2N2O7S and a molecular weight of 470.45 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 31977934 |
| Molecular Formula | C20H20F2N2O7S |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] (E)-3-[4-methoxy-3-(methylsulfamoyl)phenyl]prop-2-enoate |
| SMILES | CNS(=O)(=O)c1cc(/C=C/C(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)ccc1OC |
| InChI | InChI=1S/C20H20F2N2O7S/c1-23-32(27,28)17-11-13(3-9-16(17)29-2)4-10-19(26)30-12-18(25)24-14-5-7-15(8-6-14)31-20(21)22/h3-11,20,23H,12H2,1-2H3,(H,24,25)/b10-4+ |
| InChIKey | DHGRZBFIBMZXTR-ONNFQVAWSA-N |
| XLogP | 2.40 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|