C20H19F2NO6 — CID 4563686
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 4563686) has the molecular formula C20H19F2NO6 and a molecular weight of 407.37 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4563686 |
| Molecular Formula | C20H19F2NO6 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C=CC(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C20H19F2NO6/c1-26-16-8-9-17(27-2)13(11-16)3-10-19(25)28-12-18(24)23-14-4-6-15(7-5-14)29-20(21)22/h3-11,20H,12H2,1-2H3,(H,23,24) |
| InChIKey | JMXAZWQXDLMOLU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|