C20H20BrNO5 — CID 71954149
[2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 71954149) has the molecular formula C20H20BrNO5 and a molecular weight of 434.29 g/mol. Its IUPAC name is [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 71954149 |
| Molecular Formula | C20H20BrNO5 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | [2-(4-bromo-3-methylanilino)-2-oxoethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C=CC(=O)OCC(=O)Nc2ccc(Br)c(C)c2)c1 |
| InChI | InChI=1S/C20H20BrNO5/c1-13-10-15(5-7-17(13)21)22-19(23)12-27-20(24)9-4-14-11-16(25-2)6-8-18(14)26-3/h4-11H,12H2,1-3H3,(H,22,23) |
| InChIKey | VHHRYVRZJILWJS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|