C20H18F3NO6 — CID 5076449
[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 5076449) has the molecular formula C20H18F3NO6 and a molecular weight of 425.36 g/mol. Its IUPAC name is [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5076449 |
| Molecular Formula | C20H18F3NO6 |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl] 3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(C=CC(=O)OCC(=O)Nc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C20H18F3NO6/c1-27-16-8-9-17(28-2)13(11-16)3-10-19(26)29-12-18(25)24-14-4-6-15(7-5-14)30-20(21,22)23/h3-11H,12H2,1-2H3,(H,24,25) |
| InChIKey | QRJLJPWGKFFAPF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|