C15H16BrNO5 — CID 5200911
4-O-[2-(4-bromo-3-methylanilino)-2-oxoethyl] 1-O-ethyl but-2-enedioate (PubChem CID 5200911) has the molecular formula C15H16BrNO5 and a molecular weight of 370.20 g/mol. Its IUPAC name is 4-O-[2-(4-bromo-3-methylanilino)-2-oxoethyl] 1-O-ethyl but-2-enedioate.
| Compound Name | 4-O-[2-(4-bromo-3-methylanilino)-2-oxoethyl] 1-O-ethyl but-2-enedioate |
|---|---|
| PubChem CID | 5200911 |
| Molecular Formula | C15H16BrNO5 |
| Molecular Weight | 370.20 g/mol |
| Exact Mass | 369.02 |
| IUPAC Name | 4-O-[2-(4-bromo-3-methylanilino)-2-oxoethyl] 1-O-ethyl but-2-enedioate |
| SMILES | CCOC(=O)C=CC(=O)OCC(=O)Nc1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C15H16BrNO5/c1-3-21-14(19)6-7-15(20)22-9-13(18)17-11-4-5-12(16)10(2)8-11/h4-8H,3,9H2,1-2H3,(H,17,18) |
| InChIKey | GRUMBJVEXZCCCE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|