C11H14BrNO3 — CID 110678339
N-(4-bromo-3-methylphenyl)-2-(2-hydroxyethoxy)acetamide (PubChem CID 110678339) has the molecular formula C11H14BrNO3 and a molecular weight of 288.14 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(2-hydroxyethoxy)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(2-hydroxyethoxy)acetamide |
|---|---|
| PubChem CID | 110678339 |
| Molecular Formula | C11H14BrNO3 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(2-hydroxyethoxy)acetamide |
| SMILES | Cc1cc(NC(=O)COCCO)ccc1Br |
| InChI | InChI=1S/C11H14BrNO3/c1-8-6-9(2-3-10(8)12)13-11(15)7-16-5-4-14/h2-3,6,14H,4-5,7H2,1H3,(H,13,15) |
| InChIKey | AHFAQGGCYUXPBG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|