C16H16BrNO4S — CID 51174629
N-(4-bromo-3-methylphenyl)-2-(4-methylsulfonylphenoxy)acetamide (PubChem CID 51174629) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(4-methylsulfonylphenoxy)acetamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(4-methylsulfonylphenoxy)acetamide |
|---|---|
| PubChem CID | 51174629 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(4-methylsulfonylphenoxy)acetamide |
| SMILES | Cc1cc(NC(=O)COc2ccc(S(C)(=O)=O)cc2)ccc1Br |
| InChI | InChI=1S/C16H16BrNO4S/c1-11-9-12(3-8-15(11)17)18-16(19)10-22-13-4-6-14(7-5-13)23(2,20)21/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | RLQURSWECYIGQE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |