C18H18BrNO4 — CID 7695168
methyl 2-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]acetate (PubChem CID 7695168) has the molecular formula C18H18BrNO4 and a molecular weight of 392.25 g/mol. Its IUPAC name is methyl 2-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]acetate |
|---|---|
| PubChem CID | 7695168 |
| Molecular Formula | C18H18BrNO4 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | methyl 2-[4-[2-(4-bromo-3-methylanilino)-2-oxoethoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCC(=O)Nc2ccc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C18H18BrNO4/c1-12-9-14(5-8-16(12)19)20-17(21)11-24-15-6-3-13(4-7-15)10-18(22)23-2/h3-9H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | LGOXFACYIJBRFL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |