C16H17NO6 — CID 7851838
4-O-[2-(4-acetylanilino)-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate (PubChem CID 7851838) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 4-O-[2-(4-acetylanilino)-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-(4-acetylanilino)-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 7851838 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 4-O-[2-(4-acetylanilino)-2-oxoethyl] 1-O-ethyl (E)-but-2-enedioate |
| SMILES | CCOC(=O)/C=C/C(=O)OCC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C16H17NO6/c1-3-22-15(20)8-9-16(21)23-10-14(19)17-13-6-4-12(5-7-13)11(2)18/h4-9H,3,10H2,1-2H3,(H,17,19)/b9-8+ |
| InChIKey | GNFWQDWRADVIDB-CMDGGOBGSA-N |
| XLogP | 1.49 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|