C17H15NO7S — CID 1118035
4-[[5-[(E)-2-carboxyethenyl]-2-methoxyphenyl]sulfonylamino]benzoic acid (PubChem CID 1118035) has the molecular formula C17H15NO7S and a molecular weight of 377.37 g/mol. Its IUPAC name is 4-[[5-[(E)-2-carboxyethenyl]-2-methoxyphenyl]sulfonylamino]benzoic acid.
| Compound Name | 4-[[5-[(E)-2-carboxyethenyl]-2-methoxyphenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 1118035 |
| Molecular Formula | C17H15NO7S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 4-[[5-[(E)-2-carboxyethenyl]-2-methoxyphenyl]sulfonylamino]benzoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1S(=O)(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO7S/c1-25-14-8-2-11(3-9-16(19)20)10-15(14)26(23,24)18-13-6-4-12(5-7-13)17(21)22/h2-10,18H,1H3,(H,19,20)(H,21,22)/b9-3+ |
| InChIKey | MPQBLNOMRNYVFE-YCRREMRBSA-N |
| XLogP | 2.29 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|