C19H19N3O7S — CID 55663076
(E)-3-[3-[[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid (PubChem CID 55663076) has the molecular formula C19H19N3O7S and a molecular weight of 433.44 g/mol. Its IUPAC name is (E)-3-[3-[[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55663076 |
| Molecular Formula | C19H19N3O7S |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (E)-3-[3-[[3-[(2-amino-2-oxoethyl)carbamoyl]phenyl]sulfamoyl]-4-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1S(=O)(=O)Nc1cccc(C(=O)NCC(N)=O)c1 |
| InChI | InChI=1S/C19H19N3O7S/c1-29-15-7-5-12(6-8-18(24)25)9-16(15)30(27,28)22-14-4-2-3-13(10-14)19(26)21-11-17(20)23/h2-10,22H,11H2,1H3,(H2,20,23)(H,21,26)(H,24,25)/b8-6+ |
| InChIKey | ZEYMDQYDHNUSCJ-SOFGYWHQSA-N |
| XLogP | 0.81 |
| TPSA | 164.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|