C17H17NO6S — CID 67019506
3-[3-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 67019506) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is 3-[3-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67019506 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 3-[3-[(3,4-dimethoxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2cccc(C=CC(=O)O)c2)cc1OC |
| InChI | InChI=1S/C17H17NO6S/c1-23-15-8-7-13(11-16(15)24-2)18-25(21,22)14-5-3-4-12(10-14)6-9-17(19)20/h3-11,18H,1-2H3,(H,19,20) |
| InChIKey | MRZOTPUTLUSUSN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|