C20H18N2O5S3 — CID 55814659
(E)-3-[4-methoxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 55814659) has the molecular formula C20H18N2O5S3 and a molecular weight of 462.57 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-methoxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 55814659 |
| Molecular Formula | C20H18N2O5S3 |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | (E)-3-[4-methoxy-3-[[4-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]phenyl]sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1S(=O)(=O)Nc1ccc(Sc2nc(C)cs2)cc1 |
| InChI | InChI=1S/C20H18N2O5S3/c1-13-12-28-20(21-13)29-16-7-5-15(6-8-16)22-30(25,26)18-11-14(4-10-19(23)24)3-9-17(18)27-2/h3-12,22H,1-2H3,(H,23,24)/b10-4+ |
| InChIKey | HFALNSCVVWPNSL-ONNFQVAWSA-N |
| XLogP | 4.51 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|