C19H24ClNO3S — CID 66485819
5-tert-butyl-N-[(2-chlorophenyl)methyl]-2-ethoxybenzenesulfonamide (PubChem CID 66485819) has the molecular formula C19H24ClNO3S and a molecular weight of 381.93 g/mol. Its IUPAC name is 5-tert-butyl-N-[(2-chlorophenyl)methyl]-2-ethoxybenzenesulfonamide.
| Compound Name | 5-tert-butyl-N-[(2-chlorophenyl)methyl]-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 66485819 |
| Molecular Formula | C19H24ClNO3S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 5-tert-butyl-N-[(2-chlorophenyl)methyl]-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(C(C)(C)C)cc1S(=O)(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H24ClNO3S/c1-5-24-17-11-10-15(19(2,3)4)12-18(17)25(22,23)21-13-14-8-6-7-9-16(14)20/h6-12,21H,5,13H2,1-4H3 |
| InChIKey | UTMPYRVNXKZZGQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |