C17H21ClN2O3S — CID 7574330
5-tert-butyl-N-(5-chloro-2-pyridinyl)-2-ethoxybenzenesulfonamide (PubChem CID 7574330) has the molecular formula C17H21ClN2O3S and a molecular weight of 368.89 g/mol. Its IUPAC name is 5-tert-butyl-N-(5-chloro-2-pyridinyl)-2-ethoxybenzenesulfonamide.
| Compound Name | 5-tert-butyl-N-(5-chloro-2-pyridinyl)-2-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 7574330 |
| Molecular Formula | C17H21ClN2O3S |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 5-tert-butyl-N-(5-chloro-2-pyridinyl)-2-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(C(C)(C)C)cc1S(=O)(=O)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C17H21ClN2O3S/c1-5-23-14-8-6-12(17(2,3)4)10-15(14)24(21,22)20-16-9-7-13(18)11-19-16/h6-11H,5H2,1-4H3,(H,19,20) |
| InChIKey | AJFBXLKRQLKINN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |