C16H18ClNO3S — CID 37477890
N-[(2-chlorophenyl)methyl]-4-ethoxy-3-methylbenzenesulfonamide (PubChem CID 37477890) has the molecular formula C16H18ClNO3S and a molecular weight of 339.84 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-4-ethoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-4-ethoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 37477890 |
| Molecular Formula | C16H18ClNO3S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-4-ethoxy-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2ccccc2Cl)cc1C |
| InChI | InChI=1S/C16H18ClNO3S/c1-3-21-16-9-8-14(10-12(16)2)22(19,20)18-11-13-6-4-5-7-15(13)17/h4-10,18H,3,11H2,1-2H3 |
| InChIKey | NTRYSCFWABNPBG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |