C17H23N3O3S — CID 39660540
N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-ethoxy-3-methylbenzenesulfonamide (PubChem CID 39660540) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-ethoxy-3-methylbenzenesulfonamide.
| Compound Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-ethoxy-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39660540 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-4-ethoxy-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCc2cccnc2N(C)C)cc1C |
| InChI | InChI=1S/C17H23N3O3S/c1-5-23-16-9-8-15(11-13(16)2)24(21,22)19-12-14-7-6-10-18-17(14)20(3)4/h6-11,19H,5,12H2,1-4H3 |
| InChIKey | FBMILQCZCBCKGT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |