C21H22ClN2O8S2- — CID 2445207
(E)-3-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-4,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 2445207) has the molecular formula C21H22ClN2O8S2- and a molecular weight of 530.00 g/mol. Its IUPAC name is (E)-3-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-4,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | (E)-3-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-4,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2445207 |
| Molecular Formula | C21H22ClN2O8S2- |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | (E)-3-[3-[4-(4-chlorophenyl)sulfonylpiperazin-1-yl]sulfonyl-4,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)[O-])cc(S(=O)(=O)N2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)c1OC |
| InChI | InChI=1S/C21H23ClN2O8S2/c1-31-18-13-15(3-8-20(25)26)14-19(21(18)32-2)34(29,30)24-11-9-23(10-12-24)33(27,28)17-6-4-16(22)5-7-17/h3-8,13-14H,9-12H2,1-2H3,(H,25,26)/p-1/b8-3+ |
| InChIKey | ZRCKWXFRFFYPDE-FPYGCLRLSA-M |
| XLogP | 0.82 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|