C22H23NO7S — CID 3893951
2-oxopropyl 3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 3893951) has the molecular formula C22H23NO7S and a molecular weight of 445.49 g/mol. Its IUPAC name is 2-oxopropyl 3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | 2-oxopropyl 3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 3893951 |
| Molecular Formula | C22H23NO7S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-oxopropyl 3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OCC(C)=O)cc(S(=O)(=O)N2CCc3ccccc32)c1OC |
| InChI | InChI=1S/C22H23NO7S/c1-15(24)14-30-21(25)9-8-16-12-19(28-2)22(29-3)20(13-16)31(26,27)23-11-10-17-6-4-5-7-18(17)23/h4-9,12-13H,10-11,14H2,1-3H3 |
| InChIKey | DYTPNNKXBCIADJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|