C29H30N2O7S — CID 2487069
[2-(2,4-dimethylanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 2487069) has the molecular formula C29H30N2O7S and a molecular weight of 550.63 g/mol. Its IUPAC name is [2-(2,4-dimethylanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | [2-(2,4-dimethylanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2487069 |
| Molecular Formula | C29H30N2O7S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | [2-(2,4-dimethylanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2ccc(C)cc2C)cc(S(=O)(=O)N2CCc3ccccc32)c1OC |
| InChI | InChI=1S/C29H30N2O7S/c1-19-9-11-23(20(2)15-19)30-27(32)18-38-28(33)12-10-21-16-25(36-3)29(37-4)26(17-21)39(34,35)31-14-13-22-7-5-6-8-24(22)31/h5-12,15-17H,13-14,18H2,1-4H3,(H,30,32)/b12-10+ |
| InChIKey | NFIPEYXMCFYMQF-ZRDIBKRKSA-N |
| XLogP | 4.27 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|