C27H25ClN2O7S — CID 2646231
[2-(3-chloroanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate (PubChem CID 2646231) has the molecular formula C27H25ClN2O7S and a molecular weight of 557.02 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 2646231 |
| Molecular Formula | C27H25ClN2O7S |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] (E)-3-[3-(2,3-dihydroindol-1-ylsulfonyl)-4,5-dimethoxyphenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)Nc2cccc(Cl)c2)cc(S(=O)(=O)N2CCc3ccccc32)c1OC |
| InChI | InChI=1S/C27H25ClN2O7S/c1-35-23-14-18(10-11-26(32)37-17-25(31)29-21-8-5-7-20(28)16-21)15-24(27(23)36-2)38(33,34)30-13-12-19-6-3-4-9-22(19)30/h3-11,14-16H,12-13,17H2,1-2H3,(H,29,31)/b11-10+ |
| InChIKey | BJYFAAMZWXEGQY-ZHACJKMWSA-N |
| XLogP | 4.30 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|