C21H22Cl2N2O5S — CID 26872326
(E)-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 26872326) has the molecular formula C21H22Cl2N2O5S and a molecular weight of 485.39 g/mol. Its IUPAC name is (E)-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 26872326 |
| Molecular Formula | C21H22Cl2N2O5S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | (E)-1-[4-(2,3-dichlorophenyl)sulfonylpiperazin-1-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCN(S(=O)(=O)c3cccc(Cl)c3Cl)CC2)cc1OC |
| InChI | InChI=1S/C21H22Cl2N2O5S/c1-29-17-8-6-15(14-18(17)30-2)7-9-20(26)24-10-12-25(13-11-24)31(27,28)19-5-3-4-16(22)21(19)23/h3-9,14H,10-13H2,1-2H3/b9-7+ |
| InChIKey | CBFBTCDKQZOFIK-VQHVLOKHSA-N |
| XLogP | 3.56 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|